About 7-[[(1R)-2,2-difluoro-1-(methoxymethyl)cyclopropyl]methyl]-2-oxa-7-azaspiro[4.4]nonane
7-[[(1R)-2,2-difluoro-1-(methoxymethyl)cyclopropyl]methyl]-2-oxa-7-azaspiro[4.4]nonane (PubChem CID 178037764) has the molecular formula C13H21F2NO2
and a molecular weight of 261.31 g/mol. Its IUPAC name is 7-[[(1R)-2,2-difluoro-1-(methoxymethyl)cyclopropyl]methyl]-2-oxa-7-azaspiro[4.4]nonane.
Molecular Properties
| Compound Name | 7-[[(1R)-2,2-difluoro-1-(methoxymethyl)cyclopropyl]methyl]-2-oxa-7-azaspiro[4.4]nonane |
| PubChem CID | 178037764 |
| Molecular Formula | C13H21F2NO2 |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 7-[[(1R)-2,2-difluoro-1-(methoxymethyl)cyclopropyl]methyl]-2-oxa-7-azaspiro[4.4]nonane |
| SMILES | COC[C@]1(CN2CCC3(CCOC3)C2)CC1(F)F |
| InChI | InChI=1S/C13H21F2NO2/c1-17-10-12(6-13(12,14)15)8-16-4-2-11(7-16)3-5-18-9-11/h2-10H2,1H3/t11?,12-/m1/s1 |
| InChIKey | HINKBIFHPSJNIK-PIJUOVFKSA-N |
| XLogP | 1.77 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-[[(1R)-2,2-difluoro-1-(methoxymethyl)cyclopropyl]methyl]-2-oxa-7-azaspiro[4.4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[[(1R)-2,2-difluoro-1-(methoxymethyl)cyclopropyl]methyl]-2-oxa-7-azaspiro[4.4]nonane?
The IUPAC name of 7-[[(1R)-2,2-difluoro-1-(methoxymethyl)cyclopropyl]methyl]-2-oxa-7-azaspiro[4.4]nonane (CID 178037764) is 7-[[(1R)-2,2-difluoro-1-(methoxymethyl)cyclopropyl]methyl]-2-oxa-7-azaspiro[4.4]nonane.
What is the SMILES notation for 7-[[(1R)-2,2-difluoro-1-(methoxymethyl)cyclopropyl]methyl]-2-oxa-7-azaspiro[4.4]nonane?
The canonical SMILES for 7-[[(1R)-2,2-difluoro-1-(methoxymethyl)cyclopropyl]methyl]-2-oxa-7-azaspiro[4.4]nonane is COC[C@]1(CN2CCC3(CCOC3)C2)CC1(F)F.
What is the InChIKey of 7-[[(1R)-2,2-difluoro-1-(methoxymethyl)cyclopropyl]methyl]-2-oxa-7-azaspiro[4.4]nonane?
The InChIKey is HINKBIFHPSJNIK-PIJUOVFKSA-N. The full InChI is InChI=1S/C13H21F2NO2/c1-17-10-12(6-13(12,14)15)8-16-4-2-11(7-16)3-5-18-9-11/h2-10H2,1H3/t11?,12-/m1/s1.
What are the key properties of 7-[[(1R)-2,2-difluoro-1-(methoxymethyl)cyclopropyl]methyl]-2-oxa-7-azaspiro[4.4]nonane?
7-[[(1R)-2,2-difluoro-1-(methoxymethyl)cyclopropyl]methyl]-2-oxa-7-azaspiro[4.4]nonane has a molecular weight of 261.31 g/mol, XLogP of 1.77, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[[(1R)-2,2-difluoro-1-(methoxymethyl)cyclopropyl]methyl]-2-oxa-7-azaspiro[4.4]nonane is sourced from PubChem (CID 178037764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).