C9H6ClNO3 — CID 178038672
methyl 2-chlorofuro[3,2-b]pyridine-7-carboxylate (PubChem CID 178038672) has the molecular formula C9H6ClNO3 and a molecular weight of 211.60 g/mol. Its IUPAC name is methyl 2-chlorofuro[3,2-b]pyridine-7-carboxylate.
| Compound Name | methyl 2-chlorofuro[3,2-b]pyridine-7-carboxylate |
|---|---|
| PubChem CID | 178038672 |
| Molecular Formula | C9H6ClNO3 |
| Molecular Weight | 211.60 g/mol |
| Exact Mass | 211.00 |
| IUPAC Name | methyl 2-chlorofuro[3,2-b]pyridine-7-carboxylate |
| SMILES | COC(=O)c1ccnc2cc(Cl)oc12 |
| InChI | InChI=1S/C9H6ClNO3/c1-13-9(12)5-2-3-11-6-4-7(10)14-8(5)6/h2-4H,1H3 |
| InChIKey | XYKDHEKRYNUHKO-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.60 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |