C10H10FNO — CID 178038832
5-fluoro-7-propan-2-yl-1,3-benzoxazole (PubChem CID 178038832) has the molecular formula C10H10FNO and a molecular weight of 179.19 g/mol. Its IUPAC name is 5-fluoro-7-propan-2-yl-1,3-benzoxazole.
| Compound Name | 5-fluoro-7-propan-2-yl-1,3-benzoxazole |
|---|---|
| PubChem CID | 178038832 |
| Molecular Formula | C10H10FNO |
| Molecular Weight | 179.19 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 5-fluoro-7-propan-2-yl-1,3-benzoxazole |
| SMILES | CC(C)c1cc(F)cc2ncoc12 |
| InChI | InChI=1S/C10H10FNO/c1-6(2)8-3-7(11)4-9-10(8)13-5-12-9/h3-6H,1-2H3 |
| InChIKey | XTTIPWGLLZVHBK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.19 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |