About 4-fluoro-1,5-dimethyl-4-[(E)-prop-1-enyl]piperidin-3-amine
4-fluoro-1,5-dimethyl-4-[(E)-prop-1-enyl]piperidin-3-amine (PubChem CID 178039506) has the molecular formula C10H19FN2
and a molecular weight of 186.27 g/mol. Its IUPAC name is 4-fluoro-1,5-dimethyl-4-[(E)-prop-1-enyl]piperidin-3-amine.
Molecular Properties
| Compound Name | 4-fluoro-1,5-dimethyl-4-[(E)-prop-1-enyl]piperidin-3-amine |
| PubChem CID | 178039506 |
| Molecular Formula | C10H19FN2 |
| Molecular Weight | 186.27 g/mol |
| Exact Mass | 186.15 |
| IUPAC Name | 4-fluoro-1,5-dimethyl-4-[(E)-prop-1-enyl]piperidin-3-amine |
| SMILES | C/C=C/C1(F)C(C)CN(C)CC1N |
| InChI | InChI=1S/C10H19FN2/c1-4-5-10(11)8(2)6-13(3)7-9(10)12/h4-5,8-9H,6-7,12H2,1-3H3/b5-4+ |
| InChIKey | LQAWLYYUXQENBG-SNAWJCMRSA-N |
| XLogP | 1.18 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.27 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-fluoro-1,5-dimethyl-4-[(E)-prop-1-enyl]piperidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-1,5-dimethyl-4-[(E)-prop-1-enyl]piperidin-3-amine?
The IUPAC name of 4-fluoro-1,5-dimethyl-4-[(E)-prop-1-enyl]piperidin-3-amine (CID 178039506) is 4-fluoro-1,5-dimethyl-4-[(E)-prop-1-enyl]piperidin-3-amine.
What is the SMILES notation for 4-fluoro-1,5-dimethyl-4-[(E)-prop-1-enyl]piperidin-3-amine?
The canonical SMILES for 4-fluoro-1,5-dimethyl-4-[(E)-prop-1-enyl]piperidin-3-amine is C/C=C/C1(F)C(C)CN(C)CC1N.
What is the InChIKey of 4-fluoro-1,5-dimethyl-4-[(E)-prop-1-enyl]piperidin-3-amine?
The InChIKey is LQAWLYYUXQENBG-SNAWJCMRSA-N. The full InChI is InChI=1S/C10H19FN2/c1-4-5-10(11)8(2)6-13(3)7-9(10)12/h4-5,8-9H,6-7,12H2,1-3H3/b5-4+.
What are the key properties of 4-fluoro-1,5-dimethyl-4-[(E)-prop-1-enyl]piperidin-3-amine?
4-fluoro-1,5-dimethyl-4-[(E)-prop-1-enyl]piperidin-3-amine has a molecular weight of 186.27 g/mol, XLogP of 1.18, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-1,5-dimethyl-4-[(E)-prop-1-enyl]piperidin-3-amine is sourced from PubChem (CID 178039506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).