C13H21F3N2O4 — CID 178039623
tert-butyl 4-methyl-3-oxo-2-[2-(trifluoromethoxy)ethyl]piperazine-1-carboxylate (PubChem CID 178039623) has the molecular formula C13H21F3N2O4 and a molecular weight of 326.32 g/mol. Its IUPAC name is tert-butyl 4-methyl-3-oxo-2-[2-(trifluoromethoxy)ethyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-methyl-3-oxo-2-[2-(trifluoromethoxy)ethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 178039623 |
| Molecular Formula | C13H21F3N2O4 |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | tert-butyl 4-methyl-3-oxo-2-[2-(trifluoromethoxy)ethyl]piperazine-1-carboxylate |
| SMILES | CN1CCN(C(=O)OC(C)(C)C)C(CCOC(F)(F)F)C1=O |
| InChI | InChI=1S/C13H21F3N2O4/c1-12(2,3)22-11(20)18-7-6-17(4)10(19)9(18)5-8-21-13(14,15)16/h9H,5-8H2,1-4H3 |
| InChIKey | VEJXVCKGZUGLTH-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |