About 3-fluoro-5-propan-2-yl-4,5-dihydro-1H-pyrazol-4-amine
3-fluoro-5-propan-2-yl-4,5-dihydro-1H-pyrazol-4-amine (PubChem CID 178039731) has the molecular formula C6H12FN3
and a molecular weight of 145.18 g/mol. Its IUPAC name is 3-fluoro-5-propan-2-yl-4,5-dihydro-1H-pyrazol-4-amine.
Molecular Properties
| Compound Name | 3-fluoro-5-propan-2-yl-4,5-dihydro-1H-pyrazol-4-amine |
| PubChem CID | 178039731 |
| Molecular Formula | C6H12FN3 |
| Molecular Weight | 145.18 g/mol |
| Exact Mass | 145.10 |
| IUPAC Name | 3-fluoro-5-propan-2-yl-4,5-dihydro-1H-pyrazol-4-amine |
| SMILES | CC(C)C1NN=C(F)C1N |
| InChI | InChI=1S/C6H12FN3/c1-3(2)5-4(8)6(7)10-9-5/h3-5,9H,8H2,1-2H3 |
| InChIKey | HQHOEGGTYMCLFW-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.18 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-fluoro-5-propan-2-yl-4,5-dihydro-1H-pyrazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-5-propan-2-yl-4,5-dihydro-1H-pyrazol-4-amine?
The IUPAC name of 3-fluoro-5-propan-2-yl-4,5-dihydro-1H-pyrazol-4-amine (CID 178039731) is 3-fluoro-5-propan-2-yl-4,5-dihydro-1H-pyrazol-4-amine.
What is the SMILES notation for 3-fluoro-5-propan-2-yl-4,5-dihydro-1H-pyrazol-4-amine?
The canonical SMILES for 3-fluoro-5-propan-2-yl-4,5-dihydro-1H-pyrazol-4-amine is CC(C)C1NN=C(F)C1N.
What is the InChIKey of 3-fluoro-5-propan-2-yl-4,5-dihydro-1H-pyrazol-4-amine?
The InChIKey is HQHOEGGTYMCLFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12FN3/c1-3(2)5-4(8)6(7)10-9-5/h3-5,9H,8H2,1-2H3.
What are the key properties of 3-fluoro-5-propan-2-yl-4,5-dihydro-1H-pyrazol-4-amine?
3-fluoro-5-propan-2-yl-4,5-dihydro-1H-pyrazol-4-amine has a molecular weight of 145.18 g/mol, XLogP of 0.22, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-5-propan-2-yl-4,5-dihydro-1H-pyrazol-4-amine is sourced from PubChem (CID 178039731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).