C18H42N2O6P2 — CID 178039974
8-[amino(butoxy)phosphoryl]oxy-1-[amino(pentan-3-yloxy)phosphoryl]oxynonane (PubChem CID 178039974) has the molecular formula C18H42N2O6P2 and a molecular weight of 444.49 g/mol. Its IUPAC name is 8-[amino(butoxy)phosphoryl]oxy-1-[amino(pentan-3-yloxy)phosphoryl]oxynonane.
| Compound Name | 8-[amino(butoxy)phosphoryl]oxy-1-[amino(pentan-3-yloxy)phosphoryl]oxynonane |
|---|---|
| PubChem CID | 178039974 |
| Molecular Formula | C18H42N2O6P2 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | 8-[amino(butoxy)phosphoryl]oxy-1-[amino(pentan-3-yloxy)phosphoryl]oxynonane |
| SMILES | CCCCOP(N)(=O)OC(C)CCCCCCCOP(N)(=O)OC(CC)CC |
| InChI | InChI=1S/C18H42N2O6P2/c1-5-8-15-23-27(19,21)25-17(4)14-12-10-9-11-13-16-24-28(20,22)26-18(6-2)7-3/h17-18H,5-16H2,1-4H3,(H2,19,21)(H2,20,22) |
| InChIKey | XLZSINJFXNDVGM-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 123.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|