C18H21F4N — CID 178040050
2-[(2E,4Z,6Z)-3-fluoro-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]-4,5,6,7-tetrahydro-3H-indole (PubChem CID 178040050) has the molecular formula C18H21F4N and a molecular weight of 327.37 g/mol. Its IUPAC name is 2-[(2E,4Z,6Z)-3-fluoro-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]-4,5,6,7-tetrahydro-3H-indole.
| Compound Name | 2-[(2E,4Z,6Z)-3-fluoro-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]-4,5,6,7-tetrahydro-3H-indole |
|---|---|
| PubChem CID | 178040050 |
| Molecular Formula | C18H21F4N |
| Molecular Weight | 327.37 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 2-[(2E,4Z,6Z)-3-fluoro-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]-4,5,6,7-tetrahydro-3H-indole |
| SMILES | C/C=C(F)\C(=C/C(=C/CC)C(F)(F)F)C1=NC2=C(CCCC2)C1 |
| InChI | InChI=1S/C18H21F4N/c1-3-7-13(18(20,21)22)11-14(15(19)4-2)17-10-12-8-5-6-9-16(12)23-17/h4,7,11H,3,5-6,8-10H2,1-2H3/b13-7-,14-11+,15-4+ |
| InChIKey | MFZNCUNGUIBCIW-MWLOQFDKSA-N |
| XLogP | 6.36 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.37 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|