C23H31F3N4 — CID 178040196
N'-ethenyl-2-methylprop-2-enimidamide;2-[(2Z,4E,6Z)-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine (PubChem CID 178040196) has the molecular formula C23H31F3N4 and a molecular weight of 420.52 g/mol. Its IUPAC name is N'-ethenyl-2-methylprop-2-enimidamide;2-[(2Z,4E,6Z)-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine.
| Compound Name | N'-ethenyl-2-methylprop-2-enimidamide;2-[(2Z,4E,6Z)-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 178040196 |
| Molecular Formula | C23H31F3N4 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | N'-ethenyl-2-methylprop-2-enimidamide;2-[(2Z,4E,6Z)-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine |
| SMILES | C/C=C\C(=C/C(=C/CC)C(F)(F)F)c1cc2n(n1)CCCC2.C=C/N=C(\N)C(=C)C |
| InChI | InChI=1S/C17H21F3N2.C6H10N2/c1-3-7-13(11-14(8-4-2)17(18,19)20)16-12-15-9-5-6-10-22(15)21-16;1-4-8-6(7)5(2)3/h3,7-8,11-12H,4-6,9-10H2,1-2H3;4H,1-2H2,3H3,(H2,7,8)/b7-3-,13-11+,14-8-; |
| InChIKey | BKMNCOSGCDMTET-OJOSJIEQSA-N |
| XLogP | 6.14 |
| TPSA | 56.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|