C25H26F5NO — CID 178040316
5-[(4-fluorophenyl)methyl]-3-[(2E,4Z,6Z)-3-fluoro-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]-5,6,7,8-tetrahydro-2H-1,4-benzoxazine (PubChem CID 178040316) has the molecular formula C25H26F5NO and a molecular weight of 451.48 g/mol. Its IUPAC name is 5-[(4-fluorophenyl)methyl]-3-[(2E,4Z,6Z)-3-fluoro-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]-5,6,7,8-tetrahydro-2H-1,4-benzoxazine.
| Compound Name | 5-[(4-fluorophenyl)methyl]-3-[(2E,4Z,6Z)-3-fluoro-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]-5,6,7,8-tetrahydro-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 178040316 |
| Molecular Formula | C25H26F5NO |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | 5-[(4-fluorophenyl)methyl]-3-[(2E,4Z,6Z)-3-fluoro-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]-5,6,7,8-tetrahydro-2H-1,4-benzoxazine |
| SMILES | C/C=C(F)\C(=C/C(=C/CC)C(F)(F)F)C1=NC2=C(CCCC2Cc2ccc(F)cc2)OC1 |
| InChI | InChI=1S/C25H26F5NO/c1-3-6-18(25(28,29)30)14-20(21(27)4-2)22-15-32-23-8-5-7-17(24(23)31-22)13-16-9-11-19(26)12-10-16/h4,6,9-12,14,17H,3,5,7-8,13,15H2,1-2H3/b18-6-,20-14+,21-4+ |
| InChIKey | BGFNGAUTFURJOP-ICABXOFISA-N |
| XLogP | 7.55 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|