C27H36F3NO3 — CID 178040381
2-methoxy-1H-pyridin-4-one;1-methyl-2-[(4E,6Z)-2-methyl-4-[(Z)-prop-1-enyl]-6-(trifluoromethyl)nona-2,4,6-trien-3-yl]oxycyclohexene (PubChem CID 178040381) has the molecular formula C27H36F3NO3 and a molecular weight of 479.58 g/mol. Its IUPAC name is 2-methoxy-1H-pyridin-4-one;1-methyl-2-[(4E,6Z)-2-methyl-4-[(Z)-prop-1-enyl]-6-(trifluoromethyl)nona-2,4,6-trien-3-yl]oxycyclohexene.
| Compound Name | 2-methoxy-1H-pyridin-4-one;1-methyl-2-[(4E,6Z)-2-methyl-4-[(Z)-prop-1-enyl]-6-(trifluoromethyl)nona-2,4,6-trien-3-yl]oxycyclohexene |
|---|---|
| PubChem CID | 178040381 |
| Molecular Formula | C27H36F3NO3 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | 2-methoxy-1H-pyridin-4-one;1-methyl-2-[(4E,6Z)-2-methyl-4-[(Z)-prop-1-enyl]-6-(trifluoromethyl)nona-2,4,6-trien-3-yl]oxycyclohexene |
| SMILES | C/C=C\C(=C/C(=C/CC)C(F)(F)F)C(OC1=C(C)CCCC1)=C(C)C.COc1cc(=O)cc[nH]1 |
| InChI | InChI=1S/C21H29F3O.C6H7NO2/c1-6-10-17(14-18(11-7-2)21(22,23)24)20(15(3)4)25-19-13-9-8-12-16(19)5;1-9-6-4-5(8)2-3-7-6/h6,10-11,14H,7-9,12-13H2,1-5H3;2-4H,1H3,(H,7,8)/b10-6-,17-14+,18-11-; |
| InChIKey | BASYXEMIEFPCNM-LJMQNMKDSA-N |
| XLogP | 7.93 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|