C17H22F4N2 — CID 178040401
2-[[(2E,4E,6Z)-3-(fluoromethyl)-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]iminomethyl]cyclopenten-1-amine (PubChem CID 178040401) has the molecular formula C17H22F4N2 and a molecular weight of 330.37 g/mol. Its IUPAC name is 2-[[(2E,4E,6Z)-3-(fluoromethyl)-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]iminomethyl]cyclopenten-1-amine.
| Compound Name | 2-[[(2E,4E,6Z)-3-(fluoromethyl)-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]iminomethyl]cyclopenten-1-amine |
|---|---|
| PubChem CID | 178040401 |
| Molecular Formula | C17H22F4N2 |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 2-[[(2E,4E,6Z)-3-(fluoromethyl)-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]iminomethyl]cyclopenten-1-amine |
| SMILES | C/C=C(CF)\C(=C/C(=C/CC)C(F)(F)F)\N=C\C1=C(N)CCC1 |
| InChI | InChI=1S/C17H22F4N2/c1-3-6-14(17(19,20)21)9-16(12(4-2)10-18)23-11-13-7-5-8-15(13)22/h4,6,9,11H,3,5,7-8,10,22H2,1-2H3/b12-4-,14-6-,16-9+,23-11+ |
| InChIKey | SMMQNJCUXGTNQH-ZBECTFIUSA-N |
| XLogP | 5.15 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|