C24H31F3N6 — CID 178040524
3-methanimidoyl-4-N-methylpyridine-2,4-diamine;2-[(2Z,4E,6Z)-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine (PubChem CID 178040524) has the molecular formula C24H31F3N6 and a molecular weight of 460.55 g/mol. Its IUPAC name is 3-methanimidoyl-4-N-methylpyridine-2,4-diamine;2-[(2Z,4E,6Z)-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine.
| Compound Name | 3-methanimidoyl-4-N-methylpyridine-2,4-diamine;2-[(2Z,4E,6Z)-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 178040524 |
| Molecular Formula | C24H31F3N6 |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | 3-methanimidoyl-4-N-methylpyridine-2,4-diamine;2-[(2Z,4E,6Z)-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine |
| SMILES | C/C=C\C(=C/C(=C/CC)C(F)(F)F)c1cc2n(n1)CCCC2.[H]/N=C/c1c(NC)ccnc1N |
| InChI | InChI=1S/C17H21F3N2.C7H10N4/c1-3-7-13(11-14(8-4-2)17(18,19)20)16-12-15-9-5-6-10-22(15)21-16;1-10-6-2-3-11-7(9)5(6)4-8/h3,7-8,11-12H,4-6,9-10H2,1-2H3;2-4,8H,1H3,(H3,9,10,11)/b7-3-,13-11+,14-8-;8-4+ |
| InChIKey | KQCHINXCXFFSPQ-BNOAGUOZSA-N |
| XLogP | 5.78 |
| TPSA | 92.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|