C19H28F3N — CID 178040536
(2Z)-1-methyl-2-[(3Z,5Z)-3-[(Z)-prop-1-enyl]-5-(trifluoromethyl)octa-3,5-dienylidene]azepane (PubChem CID 178040536) has the molecular formula C19H28F3N and a molecular weight of 327.43 g/mol. Its IUPAC name is (2Z)-1-methyl-2-[(3Z,5Z)-3-[(Z)-prop-1-enyl]-5-(trifluoromethyl)octa-3,5-dienylidene]azepane.
| Compound Name | (2Z)-1-methyl-2-[(3Z,5Z)-3-[(Z)-prop-1-enyl]-5-(trifluoromethyl)octa-3,5-dienylidene]azepane |
|---|---|
| PubChem CID | 178040536 |
| Molecular Formula | C19H28F3N |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | (2Z)-1-methyl-2-[(3Z,5Z)-3-[(Z)-prop-1-enyl]-5-(trifluoromethyl)octa-3,5-dienylidene]azepane |
| SMILES | C/C=C\C(=C/C(=C/CC)C(F)(F)F)C/C=C1/CCCCCN1C |
| InChI | InChI=1S/C19H28F3N/c1-4-9-16(15-17(10-5-2)19(20,21)22)12-13-18-11-7-6-8-14-23(18)3/h4,9-10,13,15H,5-8,11-12,14H2,1-3H3/b9-4-,16-15+,17-10-,18-13- |
| InChIKey | PHYPSEKIVWUFJS-FDJOQUATSA-N |
| XLogP | 6.17 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|