C19H26N2 — CID 178040741
2-[(2Z,4E,6E)-6-cyclopropylnona-2,4,6-trien-4-yl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine (PubChem CID 178040741) has the molecular formula C19H26N2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 2-[(2Z,4E,6E)-6-cyclopropylnona-2,4,6-trien-4-yl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine.
| Compound Name | 2-[(2Z,4E,6E)-6-cyclopropylnona-2,4,6-trien-4-yl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 178040741 |
| Molecular Formula | C19H26N2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 2-[(2Z,4E,6E)-6-cyclopropylnona-2,4,6-trien-4-yl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine |
| SMILES | C/C=C\C(=C/C(=C/CC)C1CC1)c1cc2n(n1)CCCC2 |
| InChI | InChI=1S/C19H26N2/c1-3-7-16(15-10-11-15)13-17(8-4-2)19-14-18-9-5-6-12-21(18)20-19/h4,7-8,13-15H,3,5-6,9-12H2,1-2H3/b8-4-,16-7-,17-13+ |
| InChIKey | FCMWZBOMZDKZKV-ZJMOITNASA-N |
| XLogP | 4.93 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|