C22H26F3N5O — CID 178040858
N-(2-methoxypyrimidin-4-yl)-2-[(2Z,4E,6Z)-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-4-amine (PubChem CID 178040858) has the molecular formula C22H26F3N5O and a molecular weight of 433.48 g/mol. Its IUPAC name is N-(2-methoxypyrimidin-4-yl)-2-[(2Z,4E,6Z)-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-4-amine.
| Compound Name | N-(2-methoxypyrimidin-4-yl)-2-[(2Z,4E,6Z)-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-4-amine |
|---|---|
| PubChem CID | 178040858 |
| Molecular Formula | C22H26F3N5O |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | N-(2-methoxypyrimidin-4-yl)-2-[(2Z,4E,6Z)-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-4-amine |
| SMILES | C/C=C\C(=C/C(=C/CC)C(F)(F)F)c1cc2n(n1)CCCC2Nc1ccnc(OC)n1 |
| InChI | InChI=1S/C22H26F3N5O/c1-4-7-15(13-16(8-5-2)22(23,24)25)18-14-19-17(9-6-12-30(19)29-18)27-20-10-11-26-21(28-20)31-3/h4,7-8,10-11,13-14,17H,5-6,9,12H2,1-3H3,(H,26,27,28)/b7-4-,15-13+,16-8- |
| InChIKey | OPKNSMPVGAQNQJ-ABCSIHOGSA-N |
| XLogP | 5.49 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|