C24H29F4N2OP — CID 178040885
(4-fluorophenyl)methanamine;[(2E,4Z,6Z)-4-(4,5,6,7-tetrahydro-1,3-benzoxazol-2-yl)-6-(trifluoromethyl)nona-2,4,6-trien-3-yl]phosphane (PubChem CID 178040885) has the molecular formula C24H29F4N2OP and a molecular weight of 468.48 g/mol. Its IUPAC name is (4-fluorophenyl)methanamine;[(2E,4Z,6Z)-4-(4,5,6,7-tetrahydro-1,3-benzoxazol-2-yl)-6-(trifluoromethyl)nona-2,4,6-trien-3-yl]phosphane.
| Compound Name | (4-fluorophenyl)methanamine;[(2E,4Z,6Z)-4-(4,5,6,7-tetrahydro-1,3-benzoxazol-2-yl)-6-(trifluoromethyl)nona-2,4,6-trien-3-yl]phosphane |
|---|---|
| PubChem CID | 178040885 |
| Molecular Formula | C24H29F4N2OP |
| Molecular Weight | 468.48 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | (4-fluorophenyl)methanamine;[(2E,4Z,6Z)-4-(4,5,6,7-tetrahydro-1,3-benzoxazol-2-yl)-6-(trifluoromethyl)nona-2,4,6-trien-3-yl]phosphane |
| SMILES | C/C=C(P)\C(=C/C(=C/CC)C(F)(F)F)c1nc2c(o1)CCCC2.NCc1ccc(F)cc1 |
| InChI | InChI=1S/C17H21F3NOP.C7H8FN/c1-3-7-11(17(18,19)20)10-12(15(23)4-2)16-21-13-8-5-6-9-14(13)22-16;8-7-3-1-6(5-9)2-4-7/h4,7,10H,3,5-6,8-9,23H2,1-2H3;1-4H,5,9H2/b11-7-,12-10+,15-4+; |
| InChIKey | NXFLHHLYRKAOTM-MUIIAQSKSA-N |
| XLogP | 6.90 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.48 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|