C23H25F5N4 — CID 178040897
2-[(2E,4E,6Z)-3-(fluoromethyl)-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]-N-(5-fluoro-2-pyridinyl)-N-methyl-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-4-amine (PubChem CID 178040897) has the molecular formula C23H25F5N4 and a molecular weight of 452.47 g/mol. Its IUPAC name is 2-[(2E,4E,6Z)-3-(fluoromethyl)-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]-N-(5-fluoro-2-pyridinyl)-N-methyl-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-4-amine.
| Compound Name | 2-[(2E,4E,6Z)-3-(fluoromethyl)-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]-N-(5-fluoro-2-pyridinyl)-N-methyl-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-4-amine |
|---|---|
| PubChem CID | 178040897 |
| Molecular Formula | C23H25F5N4 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | 2-[(2E,4E,6Z)-3-(fluoromethyl)-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]-N-(5-fluoro-2-pyridinyl)-N-methyl-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-4-amine |
| SMILES | C/C=C(CF)\C(=C/C(=C/CC)C(F)(F)F)c1cc2n(n1)CCC2N(C)c1ccc(F)cn1 |
| InChI | InChI=1S/C23H25F5N4/c1-4-6-16(23(26,27)28)11-18(15(5-2)13-24)19-12-21-20(9-10-32(21)30-19)31(3)22-8-7-17(25)14-29-22/h5-8,11-12,14,20H,4,9-10,13H2,1-3H3/b15-5-,16-6-,18-11+ |
| InChIKey | PLRRLYBRYOKOSE-LJROQDPPSA-N |
| XLogP | 6.20 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|