About 2-[(7-iodo-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl)sulfanyl]acetonitrile
2-[(7-iodo-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl)sulfanyl]acetonitrile (PubChem CID 178041178) has the molecular formula C7H4IN5S
and a molecular weight of 317.12 g/mol. Its IUPAC name is 2-[(7-iodo-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl)sulfanyl]acetonitrile.
Molecular Properties
| Compound Name | 2-[(7-iodo-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl)sulfanyl]acetonitrile |
| PubChem CID | 178041178 |
| Molecular Formula | C7H4IN5S |
| Molecular Weight | 317.12 g/mol |
| Exact Mass | 316.92 |
| IUPAC Name | 2-[(7-iodo-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl)sulfanyl]acetonitrile |
| SMILES | N#CCSc1nc(I)cc2ncnn12 |
| InChI | InChI=1S/C7H4IN5S/c8-5-3-6-10-4-11-13(6)7(12-5)14-2-1-9/h3-4H,2H2 |
| InChIKey | CGBHNCBWEDSSHT-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 66.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.12 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-[(7-iodo-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl)sulfanyl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(7-iodo-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl)sulfanyl]acetonitrile?
The IUPAC name of 2-[(7-iodo-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl)sulfanyl]acetonitrile (CID 178041178) is 2-[(7-iodo-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl)sulfanyl]acetonitrile.
What is the SMILES notation for 2-[(7-iodo-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl)sulfanyl]acetonitrile?
The canonical SMILES for 2-[(7-iodo-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl)sulfanyl]acetonitrile is N#CCSc1nc(I)cc2ncnn12.
What is the InChIKey of 2-[(7-iodo-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl)sulfanyl]acetonitrile?
The InChIKey is CGBHNCBWEDSSHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4IN5S/c8-5-3-6-10-4-11-13(6)7(12-5)14-2-1-9/h3-4H,2H2.
What are the key properties of 2-[(7-iodo-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl)sulfanyl]acetonitrile?
2-[(7-iodo-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl)sulfanyl]acetonitrile has a molecular weight of 317.12 g/mol, XLogP of 1.34, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(7-iodo-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl)sulfanyl]acetonitrile is sourced from PubChem (CID 178041178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).