About tert-butyl N-[6-chloro-5-[(1S)-2,2-difluoro-1-hydroxyethyl]pyrimidin-4-yl]carbamate
tert-butyl N-[6-chloro-5-[(1S)-2,2-difluoro-1-hydroxyethyl]pyrimidin-4-yl]carbamate (PubChem CID 178041445) has the molecular formula C11H14ClF2N3O3
and a molecular weight of 309.70 g/mol. Its IUPAC name is tert-butyl N-[6-chloro-5-[(1S)-2,2-difluoro-1-hydroxyethyl]pyrimidin-4-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[6-chloro-5-[(1S)-2,2-difluoro-1-hydroxyethyl]pyrimidin-4-yl]carbamate |
| PubChem CID | 178041445 |
| Molecular Formula | C11H14ClF2N3O3 |
| Molecular Weight | 309.70 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | tert-butyl N-[6-chloro-5-[(1S)-2,2-difluoro-1-hydroxyethyl]pyrimidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ncnc(Cl)c1[C@H](O)C(F)F |
| InChI | InChI=1S/C11H14ClF2N3O3/c1-11(2,3)20-10(19)17-9-5(6(18)8(13)14)7(12)15-4-16-9/h4,6,8,18H,1-3H3,(H,15,16,17,19)/t6-/m0/s1 |
| InChIKey | BXVCVWAJIDRPFS-LURJTMIESA-N |
| XLogP | 2.78 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.70 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl N-[6-chloro-5-[(1S)-2,2-difluoro-1-hydroxyethyl]pyrimidin-4-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[6-chloro-5-[(1S)-2,2-difluoro-1-hydroxyethyl]pyrimidin-4-yl]carbamate?
The IUPAC name of tert-butyl N-[6-chloro-5-[(1S)-2,2-difluoro-1-hydroxyethyl]pyrimidin-4-yl]carbamate (CID 178041445) is tert-butyl N-[6-chloro-5-[(1S)-2,2-difluoro-1-hydroxyethyl]pyrimidin-4-yl]carbamate.
What is the SMILES notation for tert-butyl N-[6-chloro-5-[(1S)-2,2-difluoro-1-hydroxyethyl]pyrimidin-4-yl]carbamate?
The canonical SMILES for tert-butyl N-[6-chloro-5-[(1S)-2,2-difluoro-1-hydroxyethyl]pyrimidin-4-yl]carbamate is CC(C)(C)OC(=O)Nc1ncnc(Cl)c1[C@H](O)C(F)F.
What is the InChIKey of tert-butyl N-[6-chloro-5-[(1S)-2,2-difluoro-1-hydroxyethyl]pyrimidin-4-yl]carbamate?
The InChIKey is BXVCVWAJIDRPFS-LURJTMIESA-N. The full InChI is InChI=1S/C11H14ClF2N3O3/c1-11(2,3)20-10(19)17-9-5(6(18)8(13)14)7(12)15-4-16-9/h4,6,8,18H,1-3H3,(H,15,16,17,19)/t6-/m0/s1.
What are the key properties of tert-butyl N-[6-chloro-5-[(1S)-2,2-difluoro-1-hydroxyethyl]pyrimidin-4-yl]carbamate?
tert-butyl N-[6-chloro-5-[(1S)-2,2-difluoro-1-hydroxyethyl]pyrimidin-4-yl]carbamate has a molecular weight of 309.70 g/mol, XLogP of 2.78, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[6-chloro-5-[(1S)-2,2-difluoro-1-hydroxyethyl]pyrimidin-4-yl]carbamate is sourced from PubChem (CID 178041445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).