C21H22F3N5O2 — CID 178042120
(4S)-4-methyl-5-[6-[(1S)-1-methyl-3,8-diazabicyclo[4.2.0]octan-3-yl]-4-(trifluoromethyl)-2-pyridinyl]-1,4-dihydropyrido[2,3-d][1,3]oxazin-2-one (PubChem CID 178042120) has the molecular formula C21H22F3N5O2 and a molecular weight of 433.43 g/mol. Its IUPAC name is (4S)-4-methyl-5-[6-[(1S)-1-methyl-3,8-diazabicyclo[4.2.0]octan-3-yl]-4-(trifluoromethyl)-2-pyridinyl]-1,4-dihydropyrido[2,3-d][1,3]oxazin-2-one.
| Compound Name | (4S)-4-methyl-5-[6-[(1S)-1-methyl-3,8-diazabicyclo[4.2.0]octan-3-yl]-4-(trifluoromethyl)-2-pyridinyl]-1,4-dihydropyrido[2,3-d][1,3]oxazin-2-one |
|---|---|
| PubChem CID | 178042120 |
| Molecular Formula | C21H22F3N5O2 |
| Molecular Weight | 433.43 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | (4S)-4-methyl-5-[6-[(1S)-1-methyl-3,8-diazabicyclo[4.2.0]octan-3-yl]-4-(trifluoromethyl)-2-pyridinyl]-1,4-dihydropyrido[2,3-d][1,3]oxazin-2-one |
| SMILES | C[C@@H]1OC(=O)Nc2nccc(-c3cc(C(F)(F)F)cc(N4CCC5CN[C@]5(C)C4)n3)c21 |
| InChI | InChI=1S/C21H22F3N5O2/c1-11-17-14(3-5-25-18(17)28-19(30)31-11)15-7-13(21(22,23)24)8-16(27-15)29-6-4-12-9-26-20(12,2)10-29/h3,5,7-8,11-12,26H,4,6,9-10H2,1-2H3,(H,25,28,30)/t11-,12?,20+/m0/s1 |
| InChIKey | UJXZJGHFLDCTHD-TUJCGDJYSA-N |
| XLogP | 3.97 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.43 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |