C18H26BF2N3O4 — CID 178042795
[5-fluoro-2-[[3-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]azepan-4-yl]amino]benzenecarboximidoyl]boronic acid (PubChem CID 178042795) has the molecular formula C18H26BF2N3O4 and a molecular weight of 397.23 g/mol. Its IUPAC name is [5-fluoro-2-[[3-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]azepan-4-yl]amino]benzenecarboximidoyl]boronic acid.
| Compound Name | [5-fluoro-2-[[3-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]azepan-4-yl]amino]benzenecarboximidoyl]boronic acid |
|---|---|
| PubChem CID | 178042795 |
| Molecular Formula | C18H26BF2N3O4 |
| Molecular Weight | 397.23 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | [5-fluoro-2-[[3-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]azepan-4-yl]amino]benzenecarboximidoyl]boronic acid |
| SMILES | [H]/N=C(\B(O)O)c1cc(F)ccc1NC1CCCN(C(=O)OC(C)(C)C)CC1F |
| InChI | InChI=1S/C18H26BF2N3O4/c1-18(2,3)28-17(25)24-8-4-5-15(13(21)10-24)23-14-7-6-11(20)9-12(14)16(22)19(26)27/h6-7,9,13,15,22-23,26-27H,4-5,8,10H2,1-3H3/b22-16- |
| InChIKey | SNWLUVVOZFAQHC-JWGURIENSA-N |
| XLogP | 2.36 |
| TPSA | 105.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.23 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|