C26H32F3N5O2 — CID 178042849
cyclopropane;5-[3-[pentyl(propyl)amino]indazol-1-yl]-4-(trifluoromethyl)-1,4-dihydropyrido[2,3-d][1,3]oxazin-2-one (PubChem CID 178042849) has the molecular formula C26H32F3N5O2 and a molecular weight of 503.57 g/mol. Its IUPAC name is cyclopropane;5-[3-[pentyl(propyl)amino]indazol-1-yl]-4-(trifluoromethyl)-1,4-dihydropyrido[2,3-d][1,3]oxazin-2-one.
| Compound Name | cyclopropane;5-[3-[pentyl(propyl)amino]indazol-1-yl]-4-(trifluoromethyl)-1,4-dihydropyrido[2,3-d][1,3]oxazin-2-one |
|---|---|
| PubChem CID | 178042849 |
| Molecular Formula | C26H32F3N5O2 |
| Molecular Weight | 503.57 g/mol |
| Exact Mass | 503.25 |
| IUPAC Name | cyclopropane;5-[3-[pentyl(propyl)amino]indazol-1-yl]-4-(trifluoromethyl)-1,4-dihydropyrido[2,3-d][1,3]oxazin-2-one |
| SMILES | C1CC1.CCCCCN(CCC)c1nn(-c2ccnc3c2C(C(F)(F)F)OC(=O)N3)c2ccccc12 |
| InChI | InChI=1S/C23H26F3N5O2.C3H6/c1-3-5-8-14-30(13-4-2)21-15-9-6-7-10-16(15)31(29-21)17-11-12-27-20-18(17)19(23(24,25)26)33-22(32)28-20;1-2-3-1/h6-7,9-12,19H,3-5,8,13-14H2,1-2H3,(H,27,28,32);1-3H2 |
| InChIKey | WPVBBGGJAQGAKI-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.57 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|