About tert-butyl N-[4-chloro-3-[(1R)-2,2-difluoro-1-hydroxyethyl]-2-pyridinyl]carbamate
tert-butyl N-[4-chloro-3-[(1R)-2,2-difluoro-1-hydroxyethyl]-2-pyridinyl]carbamate (PubChem CID 178043021) has the molecular formula C12H15ClF2N2O3
and a molecular weight of 308.71 g/mol. Its IUPAC name is tert-butyl N-[4-chloro-3-[(1R)-2,2-difluoro-1-hydroxyethyl]-2-pyridinyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[4-chloro-3-[(1R)-2,2-difluoro-1-hydroxyethyl]-2-pyridinyl]carbamate |
| PubChem CID | 178043021 |
| Molecular Formula | C12H15ClF2N2O3 |
| Molecular Weight | 308.71 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | tert-butyl N-[4-chloro-3-[(1R)-2,2-difluoro-1-hydroxyethyl]-2-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1nccc(Cl)c1[C@@H](O)C(F)F |
| InChI | InChI=1S/C12H15ClF2N2O3/c1-12(2,3)20-11(19)17-10-7(8(18)9(14)15)6(13)4-5-16-10/h4-5,8-9,18H,1-3H3,(H,16,17,19)/t8-/m1/s1 |
| InChIKey | UHXYOBUUVPLTHG-MRVPVSSYSA-N |
| XLogP | 3.38 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.71 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl N-[4-chloro-3-[(1R)-2,2-difluoro-1-hydroxyethyl]-2-pyridinyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[4-chloro-3-[(1R)-2,2-difluoro-1-hydroxyethyl]-2-pyridinyl]carbamate?
The IUPAC name of tert-butyl N-[4-chloro-3-[(1R)-2,2-difluoro-1-hydroxyethyl]-2-pyridinyl]carbamate (CID 178043021) is tert-butyl N-[4-chloro-3-[(1R)-2,2-difluoro-1-hydroxyethyl]-2-pyridinyl]carbamate.
What is the SMILES notation for tert-butyl N-[4-chloro-3-[(1R)-2,2-difluoro-1-hydroxyethyl]-2-pyridinyl]carbamate?
The canonical SMILES for tert-butyl N-[4-chloro-3-[(1R)-2,2-difluoro-1-hydroxyethyl]-2-pyridinyl]carbamate is CC(C)(C)OC(=O)Nc1nccc(Cl)c1[C@@H](O)C(F)F.
What is the InChIKey of tert-butyl N-[4-chloro-3-[(1R)-2,2-difluoro-1-hydroxyethyl]-2-pyridinyl]carbamate?
The InChIKey is UHXYOBUUVPLTHG-MRVPVSSYSA-N. The full InChI is InChI=1S/C12H15ClF2N2O3/c1-12(2,3)20-11(19)17-10-7(8(18)9(14)15)6(13)4-5-16-10/h4-5,8-9,18H,1-3H3,(H,16,17,19)/t8-/m1/s1.
What are the key properties of tert-butyl N-[4-chloro-3-[(1R)-2,2-difluoro-1-hydroxyethyl]-2-pyridinyl]carbamate?
tert-butyl N-[4-chloro-3-[(1R)-2,2-difluoro-1-hydroxyethyl]-2-pyridinyl]carbamate has a molecular weight of 308.71 g/mol, XLogP of 3.38, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[4-chloro-3-[(1R)-2,2-difluoro-1-hydroxyethyl]-2-pyridinyl]carbamate is sourced from PubChem (CID 178043021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).