C31H37F2N7O2 — CID 178044118
6-amino-2-[3-[4-(3,3-difluoropiperidin-1-yl)-6-[(1-methylpyrrolidin-2-yl)methoxy]pyrimidin-2-yl]-4,5,6,7-tetrahydro-1,2-benzoxazol-7-yl]-3-ethylbenzonitrile (PubChem CID 178044118) has the molecular formula C31H37F2N7O2 and a molecular weight of 577.68 g/mol. Its IUPAC name is 6-amino-2-[3-[4-(3,3-difluoropiperidin-1-yl)-6-[(1-methylpyrrolidin-2-yl)methoxy]pyrimidin-2-yl]-4,5,6,7-tetrahydro-1,2-benzoxazol-7-yl]-3-ethylbenzonitrile.
| Compound Name | 6-amino-2-[3-[4-(3,3-difluoropiperidin-1-yl)-6-[(1-methylpyrrolidin-2-yl)methoxy]pyrimidin-2-yl]-4,5,6,7-tetrahydro-1,2-benzoxazol-7-yl]-3-ethylbenzonitrile |
|---|---|
| PubChem CID | 178044118 |
| Molecular Formula | C31H37F2N7O2 |
| Molecular Weight | 577.68 g/mol |
| Exact Mass | 577.30 |
| IUPAC Name | 6-amino-2-[3-[4-(3,3-difluoropiperidin-1-yl)-6-[(1-methylpyrrolidin-2-yl)methoxy]pyrimidin-2-yl]-4,5,6,7-tetrahydro-1,2-benzoxazol-7-yl]-3-ethylbenzonitrile |
| SMILES | CCc1ccc(N)c(C#N)c1C1CCCc2c(-c3nc(OCC4CCCN4C)cc(N4CCCC(F)(F)C4)n3)noc21 |
| InChI | InChI=1S/C31H37F2N7O2/c1-3-19-10-11-24(35)23(16-34)27(19)21-8-4-9-22-28(38-42-29(21)22)30-36-25(40-14-6-12-31(32,33)18-40)15-26(37-30)41-17-20-7-5-13-39(20)2/h10-11,15,20-21H,3-9,12-14,17-18,35H2,1-2H3 |
| InChIKey | UZFKKSSMVSWGIA-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 117.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.68 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|