C28H30ClFN6O2 — CID 178044233
2'-amino-3-[4-chloro-6-[1-[(2R,3S)-3-fluoro-1-methylpyrrolidin-2-yl]ethoxy]pyrimidin-2-yl]spiro[5,6-dihydro-4H-1,2-benzoxazole-7,8'-6,7-dihydro-5H-naphthalene]-1'-carbonitrile (PubChem CID 178044233) has the molecular formula C28H30ClFN6O2 and a molecular weight of 537.04 g/mol. Its IUPAC name is 2'-amino-3-[4-chloro-6-[1-[(2R,3S)-3-fluoro-1-methylpyrrolidin-2-yl]ethoxy]pyrimidin-2-yl]spiro[5,6-dihydro-4H-1,2-benzoxazole-7,8'-6,7-dihydro-5H-naphthalene]-1'-carbonitrile.
| Compound Name | 2'-amino-3-[4-chloro-6-[1-[(2R,3S)-3-fluoro-1-methylpyrrolidin-2-yl]ethoxy]pyrimidin-2-yl]spiro[5,6-dihydro-4H-1,2-benzoxazole-7,8'-6,7-dihydro-5H-naphthalene]-1'-carbonitrile |
|---|---|
| PubChem CID | 178044233 |
| Molecular Formula | C28H30ClFN6O2 |
| Molecular Weight | 537.04 g/mol |
| Exact Mass | 536.21 |
| IUPAC Name | 2'-amino-3-[4-chloro-6-[1-[(2R,3S)-3-fluoro-1-methylpyrrolidin-2-yl]ethoxy]pyrimidin-2-yl]spiro[5,6-dihydro-4H-1,2-benzoxazole-7,8'-6,7-dihydro-5H-naphthalene]-1'-carbonitrile |
| SMILES | CC(Oc1cc(Cl)nc(-c2noc3c2CCCC32CCCc3ccc(N)c(C#N)c32)n1)[C@@H]1[C@@H](F)CCN1C |
| InChI | InChI=1S/C28H30ClFN6O2/c1-15(25-19(30)9-12-36(25)2)37-22-13-21(29)33-27(34-22)24-17-6-4-11-28(26(17)38-35-24)10-3-5-16-7-8-20(32)18(14-31)23(16)28/h7-8,13,15,19,25H,3-6,9-12,32H2,1-2H3/t15?,19-,25+,28?/m0/s1 |
| InChIKey | CWLIPQKLGHPOCB-GWPKQSOMSA-N |
| XLogP | 5.01 |
| TPSA | 114.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.04 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|