C15H27N3 — CID 178044254
2,4-dimethyl-5,6,7,8,9,10,11,12-octahydropyrimido[5,4-e]azecine;ethane (PubChem CID 178044254) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is 2,4-dimethyl-5,6,7,8,9,10,11,12-octahydropyrimido[5,4-e]azecine;ethane.
| Compound Name | 2,4-dimethyl-5,6,7,8,9,10,11,12-octahydropyrimido[5,4-e]azecine;ethane |
|---|---|
| PubChem CID | 178044254 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | 2,4-dimethyl-5,6,7,8,9,10,11,12-octahydropyrimido[5,4-e]azecine;ethane |
| SMILES | CC.Cc1nc(C)c2c(n1)CCCCNCCC2 |
| InChI | InChI=1S/C13H21N3.C2H6/c1-10-12-6-5-9-14-8-4-3-7-13(12)16-11(2)15-10;1-2/h14H,3-9H2,1-2H3;1-2H3 |
| InChIKey | IQBUJQRHGLRQDQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |