C17H21N7O2 — CID 178044267
4-[(Z)-2-[3-methoxypropyl(methyl)amino]ethenyl]-1-(6-methyl-1H-pyrazolo[5,4-d]pyrimidin-4-yl)pyrazole-3-carbaldehyde (PubChem CID 178044267) has the molecular formula C17H21N7O2 and a molecular weight of 355.40 g/mol. Its IUPAC name is 4-[(Z)-2-[3-methoxypropyl(methyl)amino]ethenyl]-1-(6-methyl-1H-pyrazolo[5,4-d]pyrimidin-4-yl)pyrazole-3-carbaldehyde.
| Compound Name | 4-[(Z)-2-[3-methoxypropyl(methyl)amino]ethenyl]-1-(6-methyl-1H-pyrazolo[5,4-d]pyrimidin-4-yl)pyrazole-3-carbaldehyde |
|---|---|
| PubChem CID | 178044267 |
| Molecular Formula | C17H21N7O2 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 4-[(Z)-2-[3-methoxypropyl(methyl)amino]ethenyl]-1-(6-methyl-1H-pyrazolo[5,4-d]pyrimidin-4-yl)pyrazole-3-carbaldehyde |
| SMILES | COCCCN(C)/C=C\c1cn(-c2nc(C)nc3[nH]ncc23)nc1C=O |
| InChI | InChI=1S/C17H21N7O2/c1-12-19-16-14(9-18-21-16)17(20-12)24-10-13(15(11-25)22-24)5-7-23(2)6-4-8-26-3/h5,7,9-11H,4,6,8H2,1-3H3,(H,18,19,20,21)/b7-5- |
| InChIKey | CCGCGICDEKNDOA-ALCCZGGFSA-N |
| XLogP | 1.60 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|