C34H40F2N8O2 — CID 178044507
6-amino-3-ethyl-2-[3-[4-[(1-methylpyrrolidin-2-yl)methoxy]-1H-pyrazolo[4,3-c]pyridin-6-yl]-4,5,6,7-tetrahydro-1,2-benzoxazol-7-yl]benzonitrile;6,6-difluoro-1-azaspiro[3.3]heptane (PubChem CID 178044507) has the molecular formula C34H40F2N8O2 and a molecular weight of 630.74 g/mol. Its IUPAC name is 6-amino-3-ethyl-2-[3-[4-[(1-methylpyrrolidin-2-yl)methoxy]-1H-pyrazolo[4,3-c]pyridin-6-yl]-4,5,6,7-tetrahydro-1,2-benzoxazol-7-yl]benzonitrile;6,6-difluoro-1-azaspiro[3.3]heptane.
| Compound Name | 6-amino-3-ethyl-2-[3-[4-[(1-methylpyrrolidin-2-yl)methoxy]-1H-pyrazolo[4,3-c]pyridin-6-yl]-4,5,6,7-tetrahydro-1,2-benzoxazol-7-yl]benzonitrile;6,6-difluoro-1-azaspiro[3.3]heptane |
|---|---|
| PubChem CID | 178044507 |
| Molecular Formula | C34H40F2N8O2 |
| Molecular Weight | 630.74 g/mol |
| Exact Mass | 630.32 |
| IUPAC Name | 6-amino-3-ethyl-2-[3-[4-[(1-methylpyrrolidin-2-yl)methoxy]-1H-pyrazolo[4,3-c]pyridin-6-yl]-4,5,6,7-tetrahydro-1,2-benzoxazol-7-yl]benzonitrile;6,6-difluoro-1-azaspiro[3.3]heptane |
| SMILES | CCc1ccc(N)c(C#N)c1C1CCCc2c(-c3cc4[nH]ncc4c(OCC4CCCN4C)n3)noc21.FC1(F)CC2(CCN2)C1 |
| InChI | InChI=1S/C28H31N7O2.C6H9F2N/c1-3-16-9-10-22(30)20(13-29)25(16)18-7-4-8-19-26(34-37-27(18)19)24-12-23-21(14-31-33-23)28(32-24)36-15-17-6-5-11-35(17)2;7-6(8)3-5(4-6)1-2-9-5/h9-10,12,14,17-18H,3-8,11,15,30H2,1-2H3,(H,31,33);9H,1-4H2 |
| InChIKey | FTKVPSNMMPILRL-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 141.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.74 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|