C22H28F2N6O2 — CID 178045839
2,2-difluoropropanal;1-[2-(methylamino)propyl]indazole-5-carbonitrile;2-pyrimidin-2-ylpropan-2-ol (PubChem CID 178045839) has the molecular formula C22H28F2N6O2 and a molecular weight of 446.50 g/mol. Its IUPAC name is 2,2-difluoropropanal;1-[2-(methylamino)propyl]indazole-5-carbonitrile;2-pyrimidin-2-ylpropan-2-ol.
| Compound Name | 2,2-difluoropropanal;1-[2-(methylamino)propyl]indazole-5-carbonitrile;2-pyrimidin-2-ylpropan-2-ol |
|---|---|
| PubChem CID | 178045839 |
| Molecular Formula | C22H28F2N6O2 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | 2,2-difluoropropanal;1-[2-(methylamino)propyl]indazole-5-carbonitrile;2-pyrimidin-2-ylpropan-2-ol |
| SMILES | CC(C)(O)c1ncccn1.CC(F)(F)C=O.CNC(C)Cn1ncc2cc(C#N)ccc21 |
| InChI | InChI=1S/C12H14N4.C7H10N2O.C3H4F2O/c1-9(14-2)8-16-12-4-3-10(6-13)5-11(12)7-15-16;1-7(2,10)6-8-4-3-5-9-6;1-3(4,5)2-6/h3-5,7,9,14H,8H2,1-2H3;3-5,10H,1-2H3;2H,1H3 |
| InChIKey | JKJJOCYNDUMMIQ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 116.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|