C14H28O — CID 178045907
4-(2,3,3,4-tetramethylpentan-2-yl)oxane (PubChem CID 178045907) has the molecular formula C14H28O and a molecular weight of 212.38 g/mol. Its IUPAC name is 4-(2,3,3,4-tetramethylpentan-2-yl)oxane.
| Compound Name | 4-(2,3,3,4-tetramethylpentan-2-yl)oxane |
|---|---|
| PubChem CID | 178045907 |
| Molecular Formula | C14H28O |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.21 |
| IUPAC Name | 4-(2,3,3,4-tetramethylpentan-2-yl)oxane |
| SMILES | CC(C)C(C)(C)C(C)(C)C1CCOCC1 |
| InChI | InChI=1S/C14H28O/c1-11(2)13(3,4)14(5,6)12-7-9-15-10-8-12/h11-12H,7-10H2,1-6H3 |
| InChIKey | HDVCUKIKMKFAQO-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |