About 2-cyclohexyl-5,7-bis(2-methoxyethoxy)-3H-quinazolin-4-one
2-cyclohexyl-5,7-bis(2-methoxyethoxy)-3H-quinazolin-4-one (PubChem CID 178046227) has the molecular formula C20H28N2O5
and a molecular weight of 376.45 g/mol. Its IUPAC name is 2-cyclohexyl-5,7-bis(2-methoxyethoxy)-3H-quinazolin-4-one.
Molecular Properties
| Compound Name | 2-cyclohexyl-5,7-bis(2-methoxyethoxy)-3H-quinazolin-4-one |
| PubChem CID | 178046227 |
| Molecular Formula | C20H28N2O5 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 2-cyclohexyl-5,7-bis(2-methoxyethoxy)-3H-quinazolin-4-one |
| SMILES | COCCOc1cc(OCCOC)c2c(=O)[nH]c(C3CCCCC3)nc2c1 |
| InChI | InChI=1S/C20H28N2O5/c1-24-8-10-26-15-12-16-18(17(13-15)27-11-9-25-2)20(23)22-19(21-16)14-6-4-3-5-7-14/h12-14H,3-11H2,1-2H3,(H,21,22,23) |
| InChIKey | QWBRZXZYQUYVLE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 82.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexyl-5,7-bis(2-methoxyethoxy)-3H-quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-5,7-bis(2-methoxyethoxy)-3H-quinazolin-4-one?
The IUPAC name of 2-cyclohexyl-5,7-bis(2-methoxyethoxy)-3H-quinazolin-4-one (CID 178046227) is 2-cyclohexyl-5,7-bis(2-methoxyethoxy)-3H-quinazolin-4-one.
What is the SMILES notation for 2-cyclohexyl-5,7-bis(2-methoxyethoxy)-3H-quinazolin-4-one?
The canonical SMILES for 2-cyclohexyl-5,7-bis(2-methoxyethoxy)-3H-quinazolin-4-one is COCCOc1cc(OCCOC)c2c(=O)[nH]c(C3CCCCC3)nc2c1.
What is the InChIKey of 2-cyclohexyl-5,7-bis(2-methoxyethoxy)-3H-quinazolin-4-one?
The InChIKey is QWBRZXZYQUYVLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28N2O5/c1-24-8-10-26-15-12-16-18(17(13-15)27-11-9-25-2)20(23)22-19(21-16)14-6-4-3-5-7-14/h12-14H,3-11H2,1-2H3,(H,21,22,23).
What are the key properties of 2-cyclohexyl-5,7-bis(2-methoxyethoxy)-3H-quinazolin-4-one?
2-cyclohexyl-5,7-bis(2-methoxyethoxy)-3H-quinazolin-4-one has a molecular weight of 376.45 g/mol, XLogP of 3.02, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-5,7-bis(2-methoxyethoxy)-3H-quinazolin-4-one is sourced from PubChem (CID 178046227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).