C29H31F5N4O2 — CID 178046490
1-[4-[2-[2,3-difluoro-6-[4-(methylaminomethyl)quinolin-6-yl]phenoxy]ethyl]-1,5-dimethylpyrazol-3-yl]-3,3,3-trifluoro-2,2-dimethylpropan-1-ol (PubChem CID 178046490) has the molecular formula C29H31F5N4O2 and a molecular weight of 562.58 g/mol. Its IUPAC name is 1-[4-[2-[2,3-difluoro-6-[4-(methylaminomethyl)quinolin-6-yl]phenoxy]ethyl]-1,5-dimethylpyrazol-3-yl]-3,3,3-trifluoro-2,2-dimethylpropan-1-ol.
| Compound Name | 1-[4-[2-[2,3-difluoro-6-[4-(methylaminomethyl)quinolin-6-yl]phenoxy]ethyl]-1,5-dimethylpyrazol-3-yl]-3,3,3-trifluoro-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 178046490 |
| Molecular Formula | C29H31F5N4O2 |
| Molecular Weight | 562.58 g/mol |
| Exact Mass | 562.24 |
| IUPAC Name | 1-[4-[2-[2,3-difluoro-6-[4-(methylaminomethyl)quinolin-6-yl]phenoxy]ethyl]-1,5-dimethylpyrazol-3-yl]-3,3,3-trifluoro-2,2-dimethylpropan-1-ol |
| SMILES | CNCc1ccnc2ccc(-c3ccc(F)c(F)c3OCCc3c(C(O)C(C)(C)C(F)(F)F)nn(C)c3C)cc12 |
| InChI | InChI=1S/C29H31F5N4O2/c1-16-19(25(37-38(16)5)27(39)28(2,3)29(32,33)34)11-13-40-26-20(7-8-22(30)24(26)31)17-6-9-23-21(14-17)18(15-35-4)10-12-36-23/h6-10,12,14,27,35,39H,11,13,15H2,1-5H3 |
| InChIKey | NJLXKVXXEKNYLU-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.58 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |