C24H23ClF3N5O4 — CID 178047190
3-chloro-N-[1-[3-[4-[[2-hydroxyethyl(methyl)amino]carbamoyl]phenyl]pyrazin-2-yl]ethyl]-5-(trifluoromethoxy)benzamide (PubChem CID 178047190) has the molecular formula C24H23ClF3N5O4 and a molecular weight of 537.93 g/mol. Its IUPAC name is 3-chloro-N-[1-[3-[4-[[2-hydroxyethyl(methyl)amino]carbamoyl]phenyl]pyrazin-2-yl]ethyl]-5-(trifluoromethoxy)benzamide.
| Compound Name | 3-chloro-N-[1-[3-[4-[[2-hydroxyethyl(methyl)amino]carbamoyl]phenyl]pyrazin-2-yl]ethyl]-5-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 178047190 |
| Molecular Formula | C24H23ClF3N5O4 |
| Molecular Weight | 537.93 g/mol |
| Exact Mass | 537.14 |
| IUPAC Name | 3-chloro-N-[1-[3-[4-[[2-hydroxyethyl(methyl)amino]carbamoyl]phenyl]pyrazin-2-yl]ethyl]-5-(trifluoromethoxy)benzamide |
| SMILES | CC(NC(=O)c1cc(Cl)cc(OC(F)(F)F)c1)c1nccnc1-c1ccc(C(=O)NN(C)CCO)cc1 |
| InChI | InChI=1S/C24H23ClF3N5O4/c1-14(31-22(35)17-11-18(25)13-19(12-17)37-24(26,27)28)20-21(30-8-7-29-20)15-3-5-16(6-4-15)23(36)32-33(2)9-10-34/h3-8,11-14,34H,9-10H2,1-2H3,(H,31,35)(H,32,36) |
| InChIKey | UCFHDOCBKIKNOT-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 116.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.93 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|