C16H14ClF3N2O — CID 178047365
N'-[1-(3-chlorophenyl)-2,2,2-trifluoro-1-hydroxyethyl]-4-methylbenzenecarboximidamide (PubChem CID 178047365) has the molecular formula C16H14ClF3N2O and a molecular weight of 342.75 g/mol. Its IUPAC name is N'-[1-(3-chlorophenyl)-2,2,2-trifluoro-1-hydroxyethyl]-4-methylbenzenecarboximidamide.
| Compound Name | N'-[1-(3-chlorophenyl)-2,2,2-trifluoro-1-hydroxyethyl]-4-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 178047365 |
| Molecular Formula | C16H14ClF3N2O |
| Molecular Weight | 342.75 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | N'-[1-(3-chlorophenyl)-2,2,2-trifluoro-1-hydroxyethyl]-4-methylbenzenecarboximidamide |
| SMILES | Cc1ccc(/C(N)=N/C(O)(c2cccc(Cl)c2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H14ClF3N2O/c1-10-5-7-11(8-6-10)14(21)22-15(23,16(18,19)20)12-3-2-4-13(17)9-12/h2-9,23H,1H3,(H2,21,22) |
| InChIKey | GBMUCABRWFUWPW-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.75 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|