About [4-[(6-ethyl-2-oxopiperidin-3-yl)methylamino]pyrrolo[2,3-d]pyrimidin-7-yl] thiohypoiodite
[4-[(6-ethyl-2-oxopiperidin-3-yl)methylamino]pyrrolo[2,3-d]pyrimidin-7-yl] thiohypoiodite (PubChem CID 178047589) has the molecular formula C14H18IN5OS
and a molecular weight of 431.30 g/mol. Its IUPAC name is [4-[(6-ethyl-2-oxopiperidin-3-yl)methylamino]pyrrolo[2,3-d]pyrimidin-7-yl] thiohypoiodite.
Molecular Properties
| Compound Name | [4-[(6-ethyl-2-oxopiperidin-3-yl)methylamino]pyrrolo[2,3-d]pyrimidin-7-yl] thiohypoiodite |
| PubChem CID | 178047589 |
| Molecular Formula | C14H18IN5OS |
| Molecular Weight | 431.30 g/mol |
| Exact Mass | 431.03 |
| IUPAC Name | [4-[(6-ethyl-2-oxopiperidin-3-yl)methylamino]pyrrolo[2,3-d]pyrimidin-7-yl] thiohypoiodite |
| SMILES | CCC1CCC(CNc2ncnc3c2ccn3SI)C(=O)N1 |
| InChI | InChI=1S/C14H18IN5OS/c1-2-10-4-3-9(14(21)19-10)7-16-12-11-5-6-20(22-15)13(11)18-8-17-12/h5-6,8-10H,2-4,7H2,1H3,(H,19,21)(H,16,17,18) |
| InChIKey | YQSDNOAIBBTMIZ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.30 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [4-[(6-ethyl-2-oxopiperidin-3-yl)methylamino]pyrrolo[2,3-d]pyrimidin-7-yl] thiohypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(6-ethyl-2-oxopiperidin-3-yl)methylamino]pyrrolo[2,3-d]pyrimidin-7-yl] thiohypoiodite?
The IUPAC name of [4-[(6-ethyl-2-oxopiperidin-3-yl)methylamino]pyrrolo[2,3-d]pyrimidin-7-yl] thiohypoiodite (CID 178047589) is [4-[(6-ethyl-2-oxopiperidin-3-yl)methylamino]pyrrolo[2,3-d]pyrimidin-7-yl] thiohypoiodite.
What is the SMILES notation for [4-[(6-ethyl-2-oxopiperidin-3-yl)methylamino]pyrrolo[2,3-d]pyrimidin-7-yl] thiohypoiodite?
The canonical SMILES for [4-[(6-ethyl-2-oxopiperidin-3-yl)methylamino]pyrrolo[2,3-d]pyrimidin-7-yl] thiohypoiodite is CCC1CCC(CNc2ncnc3c2ccn3SI)C(=O)N1.
What is the InChIKey of [4-[(6-ethyl-2-oxopiperidin-3-yl)methylamino]pyrrolo[2,3-d]pyrimidin-7-yl] thiohypoiodite?
The InChIKey is YQSDNOAIBBTMIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18IN5OS/c1-2-10-4-3-9(14(21)19-10)7-16-12-11-5-6-20(22-15)13(11)18-8-17-12/h5-6,8-10H,2-4,7H2,1H3,(H,19,21)(H,16,17,18).
What are the key properties of [4-[(6-ethyl-2-oxopiperidin-3-yl)methylamino]pyrrolo[2,3-d]pyrimidin-7-yl] thiohypoiodite?
[4-[(6-ethyl-2-oxopiperidin-3-yl)methylamino]pyrrolo[2,3-d]pyrimidin-7-yl] thiohypoiodite has a molecular weight of 431.30 g/mol, XLogP of 2.99, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(6-ethyl-2-oxopiperidin-3-yl)methylamino]pyrrolo[2,3-d]pyrimidin-7-yl] thiohypoiodite is sourced from PubChem (CID 178047589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).