About 4-methylhexyl (2S)-2-methoxy-2-phenyl-2-(trifluoromethoxy)acetate
4-methylhexyl (2S)-2-methoxy-2-phenyl-2-(trifluoromethoxy)acetate (PubChem CID 178047742) has the molecular formula C17H23F3O4
and a molecular weight of 348.36 g/mol. Its IUPAC name is 4-methylhexyl (2S)-2-methoxy-2-phenyl-2-(trifluoromethoxy)acetate.
Molecular Properties
| Compound Name | 4-methylhexyl (2S)-2-methoxy-2-phenyl-2-(trifluoromethoxy)acetate |
| PubChem CID | 178047742 |
| Molecular Formula | C17H23F3O4 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 4-methylhexyl (2S)-2-methoxy-2-phenyl-2-(trifluoromethoxy)acetate |
| SMILES | CCC(C)CCCOC(=O)[C@@](OC)(OC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C17H23F3O4/c1-4-13(2)9-8-12-23-15(21)16(22-3,24-17(18,19)20)14-10-6-5-7-11-14/h5-7,10-11,13H,4,8-9,12H2,1-3H3/t13?,16-/m0/s1 |
| InChIKey | GIQWVZXUSKRPCS-VYIIXAMBSA-N |
| XLogP | 4.39 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-methylhexyl (2S)-2-methoxy-2-phenyl-2-(trifluoromethoxy)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylhexyl (2S)-2-methoxy-2-phenyl-2-(trifluoromethoxy)acetate?
The IUPAC name of 4-methylhexyl (2S)-2-methoxy-2-phenyl-2-(trifluoromethoxy)acetate (CID 178047742) is 4-methylhexyl (2S)-2-methoxy-2-phenyl-2-(trifluoromethoxy)acetate.
What is the SMILES notation for 4-methylhexyl (2S)-2-methoxy-2-phenyl-2-(trifluoromethoxy)acetate?
The canonical SMILES for 4-methylhexyl (2S)-2-methoxy-2-phenyl-2-(trifluoromethoxy)acetate is CCC(C)CCCOC(=O)[C@@](OC)(OC(F)(F)F)c1ccccc1.
What is the InChIKey of 4-methylhexyl (2S)-2-methoxy-2-phenyl-2-(trifluoromethoxy)acetate?
The InChIKey is GIQWVZXUSKRPCS-VYIIXAMBSA-N. The full InChI is InChI=1S/C17H23F3O4/c1-4-13(2)9-8-12-23-15(21)16(22-3,24-17(18,19)20)14-10-6-5-7-11-14/h5-7,10-11,13H,4,8-9,12H2,1-3H3/t13?,16-/m0/s1.
What are the key properties of 4-methylhexyl (2S)-2-methoxy-2-phenyl-2-(trifluoromethoxy)acetate?
4-methylhexyl (2S)-2-methoxy-2-phenyl-2-(trifluoromethoxy)acetate has a molecular weight of 348.36 g/mol, XLogP of 4.39, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylhexyl (2S)-2-methoxy-2-phenyl-2-(trifluoromethoxy)acetate is sourced from PubChem (CID 178047742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).