About [2-carbamoyl-4-(propan-2-ylamino)phenyl]methyl 2-methylpropanoate;2,4-dimethylpentane
[2-carbamoyl-4-(propan-2-ylamino)phenyl]methyl 2-methylpropanoate;2,4-dimethylpentane (PubChem CID 178048174) has the molecular formula C22H38N2O3
and a molecular weight of 378.56 g/mol. Its IUPAC name is [2-carbamoyl-4-(propan-2-ylamino)phenyl]methyl 2-methylpropanoate;2,4-dimethylpentane.
Molecular Properties
| Compound Name | [2-carbamoyl-4-(propan-2-ylamino)phenyl]methyl 2-methylpropanoate;2,4-dimethylpentane |
| PubChem CID | 178048174 |
| Molecular Formula | C22H38N2O3 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.29 |
| IUPAC Name | [2-carbamoyl-4-(propan-2-ylamino)phenyl]methyl 2-methylpropanoate;2,4-dimethylpentane |
| SMILES | CC(C)CC(C)C.CC(C)Nc1ccc(COC(=O)C(C)C)c(C(N)=O)c1 |
| InChI | InChI=1S/C15H22N2O3.C7H16/c1-9(2)15(19)20-8-11-5-6-12(17-10(3)4)7-13(11)14(16)18;1-6(2)5-7(3)4/h5-7,9-10,17H,8H2,1-4H3,(H2,16,18);6-7H,5H2,1-4H3 |
| InChIKey | NMDIYFKMPGTMML-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-carbamoyl-4-(propan-2-ylamino)phenyl]methyl 2-methylpropanoate;2,4-dimethylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-carbamoyl-4-(propan-2-ylamino)phenyl]methyl 2-methylpropanoate;2,4-dimethylpentane?
The IUPAC name of [2-carbamoyl-4-(propan-2-ylamino)phenyl]methyl 2-methylpropanoate;2,4-dimethylpentane (CID 178048174) is [2-carbamoyl-4-(propan-2-ylamino)phenyl]methyl 2-methylpropanoate;2,4-dimethylpentane.
What is the SMILES notation for [2-carbamoyl-4-(propan-2-ylamino)phenyl]methyl 2-methylpropanoate;2,4-dimethylpentane?
The canonical SMILES for [2-carbamoyl-4-(propan-2-ylamino)phenyl]methyl 2-methylpropanoate;2,4-dimethylpentane is CC(C)CC(C)C.CC(C)Nc1ccc(COC(=O)C(C)C)c(C(N)=O)c1.
What is the InChIKey of [2-carbamoyl-4-(propan-2-ylamino)phenyl]methyl 2-methylpropanoate;2,4-dimethylpentane?
The InChIKey is NMDIYFKMPGTMML-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O3.C7H16/c1-9(2)15(19)20-8-11-5-6-12(17-10(3)4)7-13(11)14(16)18;1-6(2)5-7(3)4/h5-7,9-10,17H,8H2,1-4H3,(H2,16,18);6-7H,5H2,1-4H3.
What are the key properties of [2-carbamoyl-4-(propan-2-ylamino)phenyl]methyl 2-methylpropanoate;2,4-dimethylpentane?
[2-carbamoyl-4-(propan-2-ylamino)phenyl]methyl 2-methylpropanoate;2,4-dimethylpentane has a molecular weight of 378.56 g/mol, XLogP of 4.99, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-carbamoyl-4-(propan-2-ylamino)phenyl]methyl 2-methylpropanoate;2,4-dimethylpentane is sourced from PubChem (CID 178048174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).