About 4-bromo-2,5-dimethyl-1,3-benzothiazole;ethane
4-bromo-2,5-dimethyl-1,3-benzothiazole;ethane (PubChem CID 178049044) has the molecular formula C11H14BrNS
and a molecular weight of 272.21 g/mol. Its IUPAC name is 4-bromo-2,5-dimethyl-1,3-benzothiazole;ethane.
Molecular Properties
| Compound Name | 4-bromo-2,5-dimethyl-1,3-benzothiazole;ethane |
| PubChem CID | 178049044 |
| Molecular Formula | C11H14BrNS |
| Molecular Weight | 272.21 g/mol |
| Exact Mass | 271.00 |
| IUPAC Name | 4-bromo-2,5-dimethyl-1,3-benzothiazole;ethane |
| SMILES | CC.Cc1nc2c(Br)c(C)ccc2s1 |
| InChI | InChI=1S/C9H8BrNS.C2H6/c1-5-3-4-7-9(8(5)10)11-6(2)12-7;1-2/h3-4H,1-2H3;1-2H3 |
| InChIKey | UBOWPYCMCMNXRS-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.21 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromo-2,5-dimethyl-1,3-benzothiazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2,5-dimethyl-1,3-benzothiazole;ethane?
The IUPAC name of 4-bromo-2,5-dimethyl-1,3-benzothiazole;ethane (CID 178049044) is 4-bromo-2,5-dimethyl-1,3-benzothiazole;ethane.
What is the SMILES notation for 4-bromo-2,5-dimethyl-1,3-benzothiazole;ethane?
The canonical SMILES for 4-bromo-2,5-dimethyl-1,3-benzothiazole;ethane is CC.Cc1nc2c(Br)c(C)ccc2s1.
What is the InChIKey of 4-bromo-2,5-dimethyl-1,3-benzothiazole;ethane?
The InChIKey is UBOWPYCMCMNXRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrNS.C2H6/c1-5-3-4-7-9(8(5)10)11-6(2)12-7;1-2/h3-4H,1-2H3;1-2H3.
What are the key properties of 4-bromo-2,5-dimethyl-1,3-benzothiazole;ethane?
4-bromo-2,5-dimethyl-1,3-benzothiazole;ethane has a molecular weight of 272.21 g/mol, XLogP of 4.70, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2,5-dimethyl-1,3-benzothiazole;ethane is sourced from PubChem (CID 178049044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).