C12H27NO — CID 178049677
ethane;2,2,5,5-tetramethylhexanamide (PubChem CID 178049677) has the molecular formula C12H27NO and a molecular weight of 201.35 g/mol. Its IUPAC name is ethane;2,2,5,5-tetramethylhexanamide.
| Compound Name | ethane;2,2,5,5-tetramethylhexanamide |
|---|---|
| PubChem CID | 178049677 |
| Molecular Formula | C12H27NO |
| Molecular Weight | 201.35 g/mol |
| Exact Mass | 201.21 |
| IUPAC Name | ethane;2,2,5,5-tetramethylhexanamide |
| SMILES | CC.CC(C)(C)CCC(C)(C)C(N)=O |
| InChI | InChI=1S/C10H21NO.C2H6/c1-9(2,3)6-7-10(4,5)8(11)12;1-2/h6-7H2,1-5H3,(H2,11,12);1-2H3 |
| InChIKey | TZSAVIOYKIHSHU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.35 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |