C7H14N6 — CID 17805
2-N,2-N,4-N,4-N-tetramethyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 17805) has the molecular formula C7H14N6 and a molecular weight of 182.23 g/mol. Its IUPAC name is 2-N,2-N,4-N,4-N-tetramethyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N,4-N,4-N-tetramethyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 17805 |
| Molecular Formula | C7H14N6 |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 2-N,2-N,4-N,4-N-tetramethyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CN(C)c1nc(N)nc(N(C)C)n1 |
| InChI | InChI=1S/C7H14N6/c1-12(2)6-9-5(8)10-7(11-6)13(3)4/h1-4H3,(H2,8,9,10,11) |
| InChIKey | LVVRSRYXKCKALW-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |