C16H15F2NO — CID 178050281
3,9-difluoro-8-propan-2-yl-5H-phenanthridin-6-one;molecular hydrogen (PubChem CID 178050281) has the molecular formula C16H15F2NO and a molecular weight of 275.30 g/mol. Its IUPAC name is 3,9-difluoro-8-propan-2-yl-5H-phenanthridin-6-one;molecular hydrogen.
| Compound Name | 3,9-difluoro-8-propan-2-yl-5H-phenanthridin-6-one;molecular hydrogen |
|---|---|
| PubChem CID | 178050281 |
| Molecular Formula | C16H15F2NO |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 3,9-difluoro-8-propan-2-yl-5H-phenanthridin-6-one;molecular hydrogen |
| SMILES | CC(C)c1cc2c(=O)[nH]c3cc(F)ccc3c2cc1F.[H][H] |
| InChI | InChI=1S/C16H13F2NO.H2/c1-8(2)11-6-13-12(7-14(11)18)10-4-3-9(17)5-15(10)19-16(13)20;/h3-8H,1-2H3,(H,19,20);1H |
| InChIKey | YKAFOJGKKAWDSD-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|