C28H32F5N3O3S — CID 178050473
2-[[6-(1,1-dicyanoprop-1-en-2-yl)naphthalen-2-yl]-methylamino]ethyl 4,4-difluoro-3,5-dimethyl-5-(trifluoromethyl)heptane-3-sulfonate (PubChem CID 178050473) has the molecular formula C28H32F5N3O3S and a molecular weight of 585.64 g/mol. Its IUPAC name is 2-[[6-(1,1-dicyanoprop-1-en-2-yl)naphthalen-2-yl]-methylamino]ethyl 4,4-difluoro-3,5-dimethyl-5-(trifluoromethyl)heptane-3-sulfonate.
| Compound Name | 2-[[6-(1,1-dicyanoprop-1-en-2-yl)naphthalen-2-yl]-methylamino]ethyl 4,4-difluoro-3,5-dimethyl-5-(trifluoromethyl)heptane-3-sulfonate |
|---|---|
| PubChem CID | 178050473 |
| Molecular Formula | C28H32F5N3O3S |
| Molecular Weight | 585.64 g/mol |
| Exact Mass | 585.21 |
| IUPAC Name | 2-[[6-(1,1-dicyanoprop-1-en-2-yl)naphthalen-2-yl]-methylamino]ethyl 4,4-difluoro-3,5-dimethyl-5-(trifluoromethyl)heptane-3-sulfonate |
| SMILES | CCC(C)(C(F)(F)F)C(F)(F)C(C)(CC)S(=O)(=O)OCCN(C)c1ccc2cc(C(C)=C(C#N)C#N)ccc2c1 |
| InChI | InChI=1S/C28H32F5N3O3S/c1-7-25(4,28(31,32)33)27(29,30)26(5,8-2)40(37,38)39-14-13-36(6)24-12-11-21-15-20(9-10-22(21)16-24)19(3)23(17-34)18-35/h9-12,15-16H,7-8,13-14H2,1-6H3 |
| InChIKey | WGGRNVMVHOFYLS-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 94.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.64 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|