C6H7F2N — CID 178050537
N-[(1Z,3Z)-1,2-difluoropenta-1,3-dienyl]methanimine (PubChem CID 178050537) has the molecular formula C6H7F2N and a molecular weight of 131.12 g/mol. Its IUPAC name is N-[(1Z,3Z)-1,2-difluoropenta-1,3-dienyl]methanimine.
| Compound Name | N-[(1Z,3Z)-1,2-difluoropenta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 178050537 |
| Molecular Formula | C6H7F2N |
| Molecular Weight | 131.12 g/mol |
| Exact Mass | 131.05 |
| IUPAC Name | N-[(1Z,3Z)-1,2-difluoropenta-1,3-dienyl]methanimine |
| SMILES | C=N/C(F)=C(F)\C=C/C |
| InChI | InChI=1S/C6H7F2N/c1-3-4-5(7)6(8)9-2/h3-4H,2H2,1H3/b4-3-,6-5+ |
| InChIKey | VDXHAJFFDPAAFS-DNVGVPOPSA-N |
| XLogP | 2.37 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.12 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|