C23H24BN5S — CID 178050799
2-[2-(2,7-dimethylindazol-5-yl)imidazo[2,1-b][1,3]thiazol-6-yl]-7-boraspiro[3.5]nonane-7-carbonitrile (PubChem CID 178050799) has the molecular formula C23H24BN5S and a molecular weight of 413.36 g/mol. Its IUPAC name is 2-[2-(2,7-dimethylindazol-5-yl)imidazo[2,1-b][1,3]thiazol-6-yl]-7-boraspiro[3.5]nonane-7-carbonitrile.
| Compound Name | 2-[2-(2,7-dimethylindazol-5-yl)imidazo[2,1-b][1,3]thiazol-6-yl]-7-boraspiro[3.5]nonane-7-carbonitrile |
|---|---|
| PubChem CID | 178050799 |
| Molecular Formula | C23H24BN5S |
| Molecular Weight | 413.36 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | 2-[2-(2,7-dimethylindazol-5-yl)imidazo[2,1-b][1,3]thiazol-6-yl]-7-boraspiro[3.5]nonane-7-carbonitrile |
| SMILES | Cc1cc(-c2cn3cc(C4CC5(CCB(C#N)CC5)C4)nc3s2)cc2cn(C)nc12 |
| InChI | InChI=1S/C23H24BN5S/c1-15-7-16(8-17-11-28(2)27-21(15)17)20-13-29-12-19(26-22(29)30-20)18-9-23(10-18)3-5-24(14-25)6-4-23/h7-8,11-13,18H,3-6,9-10H2,1-2H3 |
| InChIKey | QFDJWICZALYJPG-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 58.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.36 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|