C12H15BrN2O2 — CID 178050969
5-bromo-6-(ethoxymethoxy)-2,7-dimethylindazole (PubChem CID 178050969) has the molecular formula C12H15BrN2O2 and a molecular weight of 299.17 g/mol. Its IUPAC name is 5-bromo-6-(ethoxymethoxy)-2,7-dimethylindazole.
| Compound Name | 5-bromo-6-(ethoxymethoxy)-2,7-dimethylindazole |
|---|---|
| PubChem CID | 178050969 |
| Molecular Formula | C12H15BrN2O2 |
| Molecular Weight | 299.17 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 5-bromo-6-(ethoxymethoxy)-2,7-dimethylindazole |
| SMILES | CCOCOc1c(Br)cc2cn(C)nc2c1C |
| InChI | InChI=1S/C12H15BrN2O2/c1-4-16-7-17-12-8(2)11-9(5-10(12)13)6-15(3)14-11/h5-6H,4,7H2,1-3H3 |
| InChIKey | RVLRTIJQARFZTF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.17 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|