C19H18N6S — CID 178051151
2-(7-ethynyl-2-methylindazol-5-yl)-6-piperidin-4-ylimidazo[2,1-b][1,3,4]thiadiazole (PubChem CID 178051151) has the molecular formula C19H18N6S and a molecular weight of 362.46 g/mol. Its IUPAC name is 2-(7-ethynyl-2-methylindazol-5-yl)-6-piperidin-4-ylimidazo[2,1-b][1,3,4]thiadiazole.
| Compound Name | 2-(7-ethynyl-2-methylindazol-5-yl)-6-piperidin-4-ylimidazo[2,1-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 178051151 |
| Molecular Formula | C19H18N6S |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 2-(7-ethynyl-2-methylindazol-5-yl)-6-piperidin-4-ylimidazo[2,1-b][1,3,4]thiadiazole |
| SMILES | C#Cc1cc(-c2nn3cc(C4CCNCC4)nc3s2)cc2cn(C)nc12 |
| InChI | InChI=1S/C19H18N6S/c1-3-12-8-14(9-15-10-24(2)22-17(12)15)18-23-25-11-16(21-19(25)26-18)13-4-6-20-7-5-13/h1,8-11,13,20H,4-7H2,2H3 |
| InChIKey | WMIGPXGSWBCART-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 60.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|