About ethane;2-ethyl-4-methylmorpholine;methane
ethane;2-ethyl-4-methylmorpholine;methane (PubChem CID 178051294) has the molecular formula C10H25NO
and a molecular weight of 175.32 g/mol. Its IUPAC name is ethane;2-ethyl-4-methylmorpholine;methane.
Molecular Properties
| Compound Name | ethane;2-ethyl-4-methylmorpholine;methane |
| PubChem CID | 178051294 |
| Molecular Formula | C10H25NO |
| Molecular Weight | 175.32 g/mol |
| Exact Mass | 175.19 |
| IUPAC Name | ethane;2-ethyl-4-methylmorpholine;methane |
| SMILES | C.CC.CCC1CN(C)CCO1 |
| InChI | InChI=1S/C7H15NO.C2H6.CH4/c1-3-7-6-8(2)4-5-9-7;1-2;/h7H,3-6H2,1-2H3;1-2H3;1H4 |
| InChIKey | OXQLADMOUGXMJO-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.32 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;2-ethyl-4-methylmorpholine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-ethyl-4-methylmorpholine;methane?
The IUPAC name of ethane;2-ethyl-4-methylmorpholine;methane (CID 178051294) is ethane;2-ethyl-4-methylmorpholine;methane.
What is the SMILES notation for ethane;2-ethyl-4-methylmorpholine;methane?
The canonical SMILES for ethane;2-ethyl-4-methylmorpholine;methane is C.CC.CCC1CN(C)CCO1.
What is the InChIKey of ethane;2-ethyl-4-methylmorpholine;methane?
The InChIKey is OXQLADMOUGXMJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO.C2H6.CH4/c1-3-7-6-8(2)4-5-9-7;1-2;/h7H,3-6H2,1-2H3;1-2H3;1H4.
What are the key properties of ethane;2-ethyl-4-methylmorpholine;methane?
ethane;2-ethyl-4-methylmorpholine;methane has a molecular weight of 175.32 g/mol, XLogP of 2.39, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-ethyl-4-methylmorpholine;methane is sourced from PubChem (CID 178051294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).