C8H13NO — CID 178051530
7-ethenyl-2-oxa-7-azaspiro[3.4]octane (PubChem CID 178051530) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is 7-ethenyl-2-oxa-7-azaspiro[3.4]octane.
| Compound Name | 7-ethenyl-2-oxa-7-azaspiro[3.4]octane |
|---|---|
| PubChem CID | 178051530 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | 7-ethenyl-2-oxa-7-azaspiro[3.4]octane |
| SMILES | C=CN1CCC2(COC2)C1 |
| InChI | InChI=1S/C8H13NO/c1-2-9-4-3-8(5-9)6-10-7-8/h2H,1,3-7H2 |
| InChIKey | RXYTYEKZUBKOQC-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |