About 4-bromo-2-chloro-3,5-dideuteriopyridine
4-bromo-2-chloro-3,5-dideuteriopyridine (PubChem CID 178051658) has the molecular formula C5H3BrClN
and a molecular weight of 194.46 g/mol. Its IUPAC name is 4-bromo-2-chloro-3,5-dideuteriopyridine.
Molecular Properties
| Compound Name | 4-bromo-2-chloro-3,5-dideuteriopyridine |
| PubChem CID | 178051658 |
| Molecular Formula | C5H3BrClN |
| Molecular Weight | 194.46 g/mol |
| Exact Mass | 192.93 |
| IUPAC Name | 4-bromo-2-chloro-3,5-dideuteriopyridine |
| SMILES | [2H]c1cnc(Cl)c([2H])c1Br |
| InChI | InChI=1S/C5H3BrClN/c6-4-1-2-8-5(7)3-4/h1-3H/i1D,3D |
| InChIKey | ONHMWUXYIFULDO-SDTNDFKLSA-N |
| XLogP | 2.50 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.46 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-2-chloro-3,5-dideuteriopyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2-chloro-3,5-dideuteriopyridine?
The IUPAC name of 4-bromo-2-chloro-3,5-dideuteriopyridine (CID 178051658) is 4-bromo-2-chloro-3,5-dideuteriopyridine.
What is the SMILES notation for 4-bromo-2-chloro-3,5-dideuteriopyridine?
The canonical SMILES for 4-bromo-2-chloro-3,5-dideuteriopyridine is [2H]c1cnc(Cl)c([2H])c1Br.
What is the InChIKey of 4-bromo-2-chloro-3,5-dideuteriopyridine?
The InChIKey is ONHMWUXYIFULDO-SDTNDFKLSA-N. The full InChI is InChI=1S/C5H3BrClN/c6-4-1-2-8-5(7)3-4/h1-3H/i1D,3D.
What are the key properties of 4-bromo-2-chloro-3,5-dideuteriopyridine?
4-bromo-2-chloro-3,5-dideuteriopyridine has a molecular weight of 194.46 g/mol, XLogP of 2.50, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-chloro-3,5-dideuteriopyridine is sourced from PubChem (CID 178051658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).